C36H41ClN4O2 — CID 19789766
benzyl 7-(6-chloro-5-ethyl-2-methyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-8-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate (PubChem CID 19789766) has the molecular formula C36H41ClN4O2 and a molecular weight of 597.20 g/mol. Its IUPAC name is benzyl 7-(6-chloro-5-ethyl-2-methyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-8-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate.
| Compound Name | benzyl 7-(6-chloro-5-ethyl-2-methyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-8-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 19789766 |
| Molecular Formula | C36H41ClN4O2 |
| Molecular Weight | 597.20 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | benzyl 7-(6-chloro-5-ethyl-2-methyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-8-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate |
| SMILES | CCN1c2c(Cl)cc(C3CCCN(C(=O)OCc4ccccc4)CCc4c3[nH]c3ccccc43)cc2C2CN(C)CCC21 |
| InChI | InChI=1S/C36H41ClN4O2/c1-3-41-33-16-18-39(2)22-30(33)29-20-25(21-31(37)35(29)41)26-13-9-17-40(36(42)43-23-24-10-5-4-6-11-24)19-15-28-27-12-7-8-14-32(27)38-34(26)28/h4-8,10-12,14,20-21,26,30,33,38H,3,9,13,15-19,22-23H2,1-2H3 |
| InChIKey | FOHHKRUCENZKNX-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.20 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |