C35H40N4O2 — CID 22848024
benzyl 7-[(4aR,9aS)-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl]-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate (PubChem CID 22848024) has the molecular formula C35H40N4O2 and a molecular weight of 548.73 g/mol. Its IUPAC name is benzyl 7-[(4aR,9aS)-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl]-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate.
| Compound Name | benzyl 7-[(4aR,9aS)-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl]-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 22848024 |
| Molecular Formula | C35H40N4O2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | benzyl 7-[(4aR,9aS)-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl]-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate |
| SMILES | CN1CC[C@@H]2c3cc(C4CCCN(C(=O)OCc5ccccc5)CCc5c4[nH]c4ccccc54)ccc3N(C)[C@@H]2C1 |
| InChI | InChI=1S/C35H40N4O2/c1-37-19-16-28-30-21-25(14-15-32(30)38(2)33(28)22-37)26-12-8-18-39(35(40)41-23-24-9-4-3-5-10-24)20-17-29-27-11-6-7-13-31(27)36-34(26)29/h3-7,9-11,13-15,21,26,28,33,36H,8,12,16-20,22-23H2,1-2H3/t26?,28-,33-/m1/s1 |
| InChIKey | CSBSFFWVMMHLKZ-TZDLKDPFSA-N |
| XLogP | 6.51 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |