C33H44N4O2 — CID 19789774
ethyl 2-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraene-7-carboxylate (PubChem CID 19789774) has the molecular formula C33H44N4O2 and a molecular weight of 528.74 g/mol. Its IUPAC name is ethyl 2-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraene-7-carboxylate.
| Compound Name | ethyl 2-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 19789774 |
| Molecular Formula | C33H44N4O2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | ethyl 2-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-7,17-diazatricyclo[8.7.0.011,16]heptadeca-1(10),11,13,15-tetraene-7-carboxylate |
| SMILES | CCOC(=O)N1CCCCC(c2ccc3c(c2)C2CCN(CC)CC2N3CC)c2[nH]c3ccccc3c2CC1 |
| InChI | InChI=1S/C33H44N4O2/c1-4-35-19-16-26-28-21-23(14-15-30(28)37(5-2)31(26)22-35)24-11-9-10-18-36(33(38)39-6-3)20-17-27-25-12-7-8-13-29(25)34-32(24)27/h7-8,12-15,21,24,26,31,34H,4-6,9-11,16-20,22H2,1-3H3 |
| InChIKey | WHJWGRVYMGBAID-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |