C37H46N4O2 — CID 67697045
benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]butan-2-yl]carbamate (PubChem CID 67697045) has the molecular formula C37H46N4O2 and a molecular weight of 578.80 g/mol. Its IUPAC name is benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]butan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 67697045 |
| Molecular Formula | C37H46N4O2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]butan-2-yl]carbamate |
| SMILES | CCC(Cc1c(C(C)c2ccc3c(c2)C2CCN(CC)CC2N3CC)[nH]c2ccccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H46N4O2/c1-5-28(38-37(42)43-24-26-13-9-8-10-14-26)22-32-29-15-11-12-16-33(29)39-36(32)25(4)27-17-18-34-31(21-27)30-19-20-40(6-2)23-35(30)41(34)7-3/h8-18,21,25,28,30,35,39H,5-7,19-20,22-24H2,1-4H3,(H,38,42) |
| InChIKey | GNFLRULJYKZLOT-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |