C21H24N2O5 — CID 90301797
3-[4-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]phenoxy]pyrrolidine-1-carboxylic acid (PubChem CID 90301797) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 3-[4-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]phenoxy]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[4-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]phenoxy]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90301797 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-[4-[(1S)-1-(phenylmethoxycarbonylamino)ethyl]phenoxy]pyrrolidine-1-carboxylic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)c1ccc(OC2CCN(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C21H24N2O5/c1-15(22-20(24)27-14-16-5-3-2-4-6-16)17-7-9-18(10-8-17)28-19-11-12-23(13-19)21(25)26/h2-10,15,19H,11-14H2,1H3,(H,22,24)(H,25,26)/t15-,19?/m0/s1 |
| InChIKey | XQDJKVBKQHPOAX-FUKCDUGKSA-N |
| XLogP | 3.81 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |