C37H46N4O2 — CID 57268953
benzyl 2-amino-2-[[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]methyl]butanoate (PubChem CID 57268953) has the molecular formula C37H46N4O2 and a molecular weight of 578.80 g/mol. Its IUPAC name is benzyl 2-amino-2-[[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]methyl]butanoate.
| Compound Name | benzyl 2-amino-2-[[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]methyl]butanoate |
|---|---|
| PubChem CID | 57268953 |
| Molecular Formula | C37H46N4O2 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | benzyl 2-amino-2-[[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]methyl]butanoate |
| SMILES | CCN1CCC2c3cc(C(C)c4[nH]c5ccccc5c4CC(N)(CC)C(=O)OCc4ccccc4)ccc3N(CC)C2C1 |
| InChI | InChI=1S/C37H46N4O2/c1-5-37(38,36(42)43-24-26-13-9-8-10-14-26)22-31-28-15-11-12-16-32(28)39-35(31)25(4)27-17-18-33-30(21-27)29-19-20-40(6-2)23-34(29)41(33)7-3/h8-18,21,25,29,34,39H,5-7,19-20,22-24,38H2,1-4H3 |
| InChIKey | RINZWTCIPDQRQW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |