C42H48N4O2 — CID 67696549
benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]-3-phenylpropan-2-yl]carbamate (PubChem CID 67696549) has the molecular formula C42H48N4O2 and a molecular weight of 640.87 g/mol. Its IUPAC name is benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67696549 |
| Molecular Formula | C42H48N4O2 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | benzyl N-[1-[2-[1-(2,9-diethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)ethyl]-1H-indol-3-yl]-3-phenylpropan-2-yl]carbamate |
| SMILES | CCN1CCC2c3cc(C(C)c4[nH]c5ccccc5c4CC(Cc4ccccc4)NC(=O)OCc4ccccc4)ccc3N(CC)C2C1 |
| InChI | InChI=1S/C42H48N4O2/c1-4-45-23-22-35-36-25-32(20-21-39(36)46(5-2)40(35)27-45)29(3)41-37(34-18-12-13-19-38(34)44-41)26-33(24-30-14-8-6-9-15-30)43-42(47)48-28-31-16-10-7-11-17-31/h6-21,25,29,33,35,40,44H,4-5,22-24,26-28H2,1-3H3,(H,43,47) |
| InChIKey | FYOVMCCQUXWISV-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |