C18H23N3O3 — CID 110809009
ethyl 4-(2-methyl-1H-indole-3-carbonyl)-1,4-diazepane-1-carboxylate (PubChem CID 110809009) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl 4-(2-methyl-1H-indole-3-carbonyl)-1,4-diazepane-1-carboxylate.
| Compound Name | ethyl 4-(2-methyl-1H-indole-3-carbonyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 110809009 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | ethyl 4-(2-methyl-1H-indole-3-carbonyl)-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-24-18(23)21-10-6-9-20(11-12-21)17(22)16-13(2)19-15-8-5-4-7-14(15)16/h4-5,7-8,19H,3,6,9-12H2,1-2H3 |
| InChIKey | PAEUVHBQIORJOE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |