C19H26N3O3+ — CID 8931936
ethyl 4-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate (PubChem CID 8931936) has the molecular formula C19H26N3O3+ and a molecular weight of 344.44 g/mol. Its IUPAC name is ethyl 4-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 8931936 |
| Molecular Formula | C19H26N3O3+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl 4-[(2S)-1-(2-methyl-1H-indol-3-yl)-1-oxopropan-2-yl]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[NH+]([C@@H](C)C(=O)c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H25N3O3/c1-4-25-19(24)22-11-9-21(10-12-22)14(3)18(23)17-13(2)20-16-8-6-5-7-15(16)17/h5-8,14,20H,4,9-12H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | FPAHQQFXCYZDIA-AWEZNQCLSA-O |
| XLogP | 1.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |