C24H28N3O2+ — CID 8591530
(2S)-2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-1-(2-methyl-1H-indol-3-yl)propan-1-one (PubChem CID 8591530) has the molecular formula C24H28N3O2+ and a molecular weight of 390.51 g/mol. Its IUPAC name is (2S)-2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-1-(2-methyl-1H-indol-3-yl)propan-1-one.
| Compound Name | (2S)-2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-1-(2-methyl-1H-indol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 8591530 |
| Molecular Formula | C24H28N3O2+ |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (2S)-2-[4-(4-acetylphenyl)piperazin-1-ium-1-yl]-1-(2-methyl-1H-indol-3-yl)propan-1-one |
| SMILES | CC(=O)c1ccc(N2CC[NH+]([C@@H](C)C(=O)c3c(C)[nH]c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-16-23(21-6-4-5-7-22(21)25-16)24(29)17(2)26-12-14-27(15-13-26)20-10-8-19(9-11-20)18(3)28/h4-11,17,25H,12-15H2,1-3H3/p+1/t17-/m0/s1 |
| InChIKey | CYDRSUJBEQDPDM-KRWDZBQOSA-O |
| XLogP | 2.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |