C27H26ClN3O — CID 17079114
2-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)-2-phenylethanone (PubChem CID 17079114) has the molecular formula C27H26ClN3O and a molecular weight of 443.98 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)-2-phenylethanone.
| Compound Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 17079114 |
| Molecular Formula | C27H26ClN3O |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2-methyl-1H-indol-3-yl)-2-phenylethanone |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(c1ccccc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C27H26ClN3O/c1-19-25(23-9-5-6-10-24(23)29-19)27(32)26(20-7-3-2-4-8-20)31-17-15-30(16-18-31)22-13-11-21(28)12-14-22/h2-14,26,29H,15-18H2,1H3 |
| InChIKey | MYNQWOMIFDXIAF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |