C23H27N3O — CID 18086318
1-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one (PubChem CID 18086318) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 1-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 18086318 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-(2-methyl-1H-indol-3-yl)-2-[4-(2-methylphenyl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1ccccc1N1CCN(C(C)C(=O)c2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C23H27N3O/c1-16-8-4-7-11-21(16)26-14-12-25(13-15-26)18(3)23(27)22-17(2)24-20-10-6-5-9-19(20)22/h4-11,18,24H,12-15H2,1-3H3 |
| InChIKey | KDYRRONFTOSBRV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |