C26H32N4O — CID 3466675
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-1-one (PubChem CID 3466675) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-1-one.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 3466675 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)propan-1-one |
| SMILES | Cc1cccc(N2CCN(C(C)C(=O)N3CCc4[nH]c5ccccc5c4C3)CC2)c1C |
| InChI | InChI=1S/C26H32N4O/c1-18-7-6-10-25(19(18)2)29-15-13-28(14-16-29)20(3)26(31)30-12-11-24-22(17-30)21-8-4-5-9-23(21)27-24/h4-10,20,27H,11-17H2,1-3H3 |
| InChIKey | FXCOZXNSJZUWTG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|