C25H22N2O6 — CID 1238868
benzyl (5S)-5-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate (PubChem CID 1238868) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is benzyl (5S)-5-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate.
| Compound Name | benzyl (5S)-5-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 1238868 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | benzyl (5S)-5-[(2-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2cc3c(cc2[C@@H]1Cc1ccccc1[N+](=O)[O-])OCO3 |
| InChI | InChI=1S/C25H22N2O6/c28-25(31-15-17-6-2-1-3-7-17)26-11-10-18-13-23-24(33-16-32-23)14-20(18)22(26)12-19-8-4-5-9-21(19)27(29)30/h1-9,13-14,22H,10-12,15-16H2/t22-/m0/s1 |
| InChIKey | BFEGKVIBCBIALS-QFIPXVFZSA-N |
| XLogP | 4.80 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|