C20H20ClN5O4 — CID 44816125
N-cyano-N'-methyl-5-[(4-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboximidamide;hydrochloride (PubChem CID 44816125) has the molecular formula C20H20ClN5O4 and a molecular weight of 429.86 g/mol. Its IUPAC name is N-cyano-N'-methyl-5-[(4-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboximidamide;hydrochloride.
| Compound Name | N-cyano-N'-methyl-5-[(4-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 44816125 |
| Molecular Formula | C20H20ClN5O4 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-cyano-N'-methyl-5-[(4-nitrophenyl)methyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline-6-carboximidamide;hydrochloride |
| SMILES | C/N=C(\NC#N)N1CCc2cc3c(cc2C1Cc1ccc([N+](=O)[O-])cc1)OCO3.Cl |
| InChI | InChI=1S/C20H19N5O4.ClH/c1-22-20(23-11-21)24-7-6-14-9-18-19(29-12-28-18)10-16(14)17(24)8-13-2-4-15(5-3-13)25(26)27;/h2-5,9-10,17H,6-8,12H2,1H3,(H,22,23);1H |
| InChIKey | FEYZWXDKYLQYCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|