C20H19F3N2O5 — CID 10788438
1-[6,7-dimethoxy-1-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 10788438) has the molecular formula C20H19F3N2O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is 1-[6,7-dimethoxy-1-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[6,7-dimethoxy-1-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 10788438 |
| Molecular Formula | C20H19F3N2O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-[6,7-dimethoxy-1-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc([N+](=O)[O-])cc1)N(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C20H19F3N2O5/c1-29-17-10-13-7-8-24(19(26)20(21,22)23)16(15(13)11-18(17)30-2)9-12-3-5-14(6-4-12)25(27)28/h3-6,10-11,16H,7-9H2,1-2H3 |
| InChIKey | VWEDKCVVEKKWLT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|