C17H22F3NO5 — CID 101215621
1-[1-(2,2-dimethoxyethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 101215621) has the molecular formula C17H22F3NO5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 1-[1-(2,2-dimethoxyethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-(2,2-dimethoxyethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 101215621 |
| Molecular Formula | C17H22F3NO5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[1-(2,2-dimethoxyethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | COc1cc2c(cc1OC)C(CC(OC)OC)N(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C17H22F3NO5/c1-23-13-7-10-5-6-21(16(22)17(18,19)20)12(9-15(25-3)26-4)11(10)8-14(13)24-2/h7-8,12,15H,5-6,9H2,1-4H3 |
| InChIKey | WHGZETPMEXXACX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|