C25H23NO6 — CID 101171933
benzyl (2R,5R,6R)-4,9-dioxo-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-triene-5-carboxylate (PubChem CID 101171933) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is benzyl (2R,5R,6R)-4,9-dioxo-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-triene-5-carboxylate.
| Compound Name | benzyl (2R,5R,6R)-4,9-dioxo-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-triene-5-carboxylate |
|---|---|
| PubChem CID | 101171933 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | benzyl (2R,5R,6R)-4,9-dioxo-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-triene-5-carboxylate |
| SMILES | O=C1C[C@@H]2c3cc4c(cc3CCN3C(=O)CC[C@]23[C@H]1C(=O)OCc1ccccc1)OCO4 |
| InChI | InChI=1S/C25H23NO6/c27-19-12-18-17-11-21-20(31-14-32-21)10-16(17)7-9-26-22(28)6-8-25(18,26)23(19)24(29)30-13-15-4-2-1-3-5-15/h1-5,10-11,18,23H,6-9,12-14H2/t18-,23-,25-/m1/s1 |
| InChIKey | JAYIVLSJKGXZAG-DVKBMCPXSA-N |
| XLogP | 2.75 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|