C17H19NO5 — CID 11209315
(2S,3R,4S,6S)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-9-one (PubChem CID 11209315) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2S,3R,4S,6S)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-9-one.
| Compound Name | (2S,3R,4S,6S)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-9-one |
|---|---|
| PubChem CID | 11209315 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2S,3R,4S,6S)-3,4-dihydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),13,15(19)-trien-9-one |
| SMILES | O=C1CC[C@]23C[C@H](O)[C@H](O)[C@H]2c2cc4c(cc2CCN13)OCO4 |
| InChI | InChI=1S/C17H19NO5/c19-11-7-17-3-1-14(20)18(17)4-2-9-5-12-13(23-8-22-12)6-10(9)15(17)16(11)21/h5-6,11,15-16,19,21H,1-4,7-8H2/t11-,15+,16-,17-/m0/s1 |
| InChIKey | LJWYMYLWNQOVDE-FKSAFCJBSA-N |
| XLogP | 0.54 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |