C17H19NO4 — CID 11748617
(1S,16S,19S)-19-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one (PubChem CID 11748617) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1S,16S,19S)-19-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one.
| Compound Name | (1S,16S,19S)-19-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one |
|---|---|
| PubChem CID | 11748617 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1S,16S,19S)-19-hydroxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one |
| SMILES | O=C1C[C@@H]2CC[C@H](O)C[C@@]23c2cc4c(cc2CCN13)OCO4 |
| InChI | InChI=1S/C17H19NO4/c19-12-2-1-11-6-16(20)18-4-3-10-5-14-15(22-9-21-14)7-13(10)17(11,18)8-12/h5,7,11-12,19H,1-4,6,8-9H2/t11-,12-,17-/m0/s1 |
| InChIKey | ACUWDCPPTRTOPF-PRXAMGSTSA-N |
| XLogP | 1.56 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |