C17H17NO3 — CID 102151805
(1R,19R)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,15,17-pentaen-19-ol (PubChem CID 102151805) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (1R,19R)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,15,17-pentaen-19-ol.
| Compound Name | (1R,19R)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,15,17-pentaen-19-ol |
|---|---|
| PubChem CID | 102151805 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (1R,19R)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,15,17-pentaen-19-ol |
| SMILES | O[C@H]1C=CC2=CCN3CCc4cc5c(cc4[C@@]23C1)OCO5 |
| InChI | InChI=1S/C17H17NO3/c19-13-2-1-12-4-6-18-5-3-11-7-15-16(21-10-20-15)8-14(11)17(12,18)9-13/h1-2,4,7-8,13,19H,3,5-6,9-10H2/t13-,17+/m0/s1 |
| InChIKey | BQGXJXYASMDFSV-SUMWQHHRSA-N |
| XLogP | 1.73 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |