C18H19NO2 — CID 102318517
(1S)-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaene (PubChem CID 102318517) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (1S)-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaene.
| Compound Name | (1S)-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaene |
|---|---|
| PubChem CID | 102318517 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (1S)-5,7-dioxa-14-azapentacyclo[12.7.0.01,17.02,10.04,8]henicosa-2,4(8),9,16,18-pentaene |
| SMILES | C1=CC2=CCN3CCCc4cc5c(cc4[C@]23CC1)OCO5 |
| InChI | InChI=1S/C18H19NO2/c1-2-7-18-14(5-1)6-9-19(18)8-3-4-13-10-16-17(11-15(13)18)21-12-20-16/h1,5-6,10-11H,2-4,7-9,12H2/t18-/m0/s1 |
| InChIKey | FXUCSLZTONLCSL-SFHVURJKSA-N |
| XLogP | 3.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |