C19H21NO4 — CID 162952605
(1R,16R,18S,21R)-21-methoxy-5,7,17-trioxa-14-azahexacyclo[12.8.0.01,18.02,10.04,8.016,18]docosa-2,4(8),9,19-tetraene (PubChem CID 162952605) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (1R,16R,18S,21R)-21-methoxy-5,7,17-trioxa-14-azahexacyclo[12.8.0.01,18.02,10.04,8.016,18]docosa-2,4(8),9,19-tetraene.
| Compound Name | (1R,16R,18S,21R)-21-methoxy-5,7,17-trioxa-14-azahexacyclo[12.8.0.01,18.02,10.04,8.016,18]docosa-2,4(8),9,19-tetraene |
|---|---|
| PubChem CID | 162952605 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (1R,16R,18S,21R)-21-methoxy-5,7,17-trioxa-14-azahexacyclo[12.8.0.01,18.02,10.04,8.016,18]docosa-2,4(8),9,19-tetraene |
| SMILES | CO[C@H]1C=C[C@@]23O[C@@H]2CN2CCCc4cc5c(cc4[C@@]23C1)OCO5 |
| InChI | InChI=1S/C19H21NO4/c1-21-13-4-5-19-17(24-19)10-20-6-2-3-12-7-15-16(23-11-22-15)8-14(12)18(19,20)9-13/h4-5,7-8,13,17H,2-3,6,9-11H2,1H3/t13-,17+,18+,19+/m0/s1 |
| InChIKey | VRSAGYCUMFTLNI-JGNHQEBTSA-N |
| XLogP | 1.98 |
| TPSA | 43.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|