C17H19NO4 — CID 22210603
(1S,13R,15S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-19-ol (PubChem CID 22210603) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (1S,13R,15S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-19-ol.
| Compound Name | (1S,13R,15S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-19-ol |
|---|---|
| PubChem CID | 22210603 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1S,13R,15S)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-19-ol |
| SMILES | CO[C@@H]1C=C[C@@]23CC(O)N(Cc4cc5c(cc42)OCO5)[C@@H]3C1 |
| InChI | InChI=1S/C17H19NO4/c1-20-11-2-3-17-7-16(19)18(15(17)5-11)8-10-4-13-14(6-12(10)17)22-9-21-13/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15-,16?,17-/m1/s1 |
| InChIKey | FOQYXUNFMVEEOA-MMIBTNLLSA-N |
| XLogP | 1.53 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|