C19H21NO5 — CID 22213266
[(1R,13R)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-yl] acetate (PubChem CID 22213266) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [(1R,13R)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-yl] acetate.
| Compound Name | [(1R,13R)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-yl] acetate |
|---|---|
| PubChem CID | 22213266 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [(1R,13R)-15-methoxy-5,7-dioxa-12-azapentacyclo[10.5.2.01,13.02,10.04,8]nonadeca-2,4(8),9,16-tetraen-18-yl] acetate |
| SMILES | COC1C=C[C@]23c4cc5c(cc4CN(CC2OC(C)=O)[C@@H]3C1)OCO5 |
| InChI | InChI=1S/C19H21NO5/c1-11(21)25-18-9-20-8-12-5-15-16(24-10-23-15)7-14(12)19(18)4-3-13(22-2)6-17(19)20/h3-5,7,13,17-18H,6,8-10H2,1-2H3/t13?,17-,18?,19-/m1/s1 |
| InChIKey | KQZABBJLTIOQQJ-CIHDQMCQSA-N |
| XLogP | 1.76 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|