C17H19NO3 — CID 10957069
(1S,16S)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one (PubChem CID 10957069) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (1S,16S)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one.
| Compound Name | (1S,16S)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one |
|---|---|
| PubChem CID | 10957069 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (1S,16S)-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9-trien-14-one |
| SMILES | O=C1C[C@@H]2CCCC[C@@]23c2cc4c(cc2CCN13)OCO4 |
| InChI | InChI=1S/C17H19NO3/c19-16-8-12-3-1-2-5-17(12)13-9-15-14(20-10-21-15)7-11(13)4-6-18(16)17/h7,9,12H,1-6,8,10H2/t12-,17-/m0/s1 |
| InChIKey | CXFZITNBRVHGND-SJCJKPOMSA-N |
| XLogP | 2.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |