C17H15NO5 — CID 175665034
(6S)-3-hydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,13,15(19)-tetraene-4,11-dione (PubChem CID 175665034) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is (6S)-3-hydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,13,15(19)-tetraene-4,11-dione.
| Compound Name | (6S)-3-hydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,13,15(19)-tetraene-4,11-dione |
|---|---|
| PubChem CID | 175665034 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (6S)-3-hydroxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),2,13,15(19)-tetraene-4,11-dione |
| SMILES | O=C1C[C@]23CCCN2C(=O)Cc2cc4c(cc2C3=C1O)OCO4 |
| InChI | InChI=1S/C17H15NO5/c19-11-7-17-2-1-3-18(17)14(20)5-9-4-12-13(23-8-22-12)6-10(9)15(17)16(11)21/h4,6,21H,1-3,5,7-8H2/t17-/m0/s1 |
| InChIKey | GZVVWMROSLITJH-KRWDZBQOSA-N |
| XLogP | 1.57 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |