C16H12N2O4 — CID 135536711
5-(4-hydroxyphenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one (PubChem CID 135536711) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one.
| Compound Name | 5-(4-hydroxyphenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one |
|---|---|
| PubChem CID | 135536711 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(4-hydroxyphenyl)-7,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one |
| SMILES | O=C1Cc2cc3c(cc2C(c2ccc(O)cc2)=NN1)OCO3 |
| InChI | InChI=1S/C16H12N2O4/c19-11-3-1-9(2-4-11)16-12-7-14-13(21-8-22-14)5-10(12)6-15(20)17-18-16/h1-5,7,19H,6,8H2,(H,17,20) |
| InChIKey | UAQQVNXIAZBQNM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|