C16H17NO5 — CID 11808847
(1S,13R)-4,5-dimethoxy-14-oxa-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-11,15-dione (PubChem CID 11808847) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (1S,13R)-4,5-dimethoxy-14-oxa-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-11,15-dione.
| Compound Name | (1S,13R)-4,5-dimethoxy-14-oxa-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-11,15-dione |
|---|---|
| PubChem CID | 11808847 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (1S,13R)-4,5-dimethoxy-14-oxa-10-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-11,15-dione |
| SMILES | COc1cc2c(cc1OC)[C@@]13CC(=O)O[C@@H]1CC(=O)N3CC2 |
| InChI | InChI=1S/C16H17NO5/c1-20-11-5-9-3-4-17-14(18)7-13-16(17,8-15(19)22-13)10(9)6-12(11)21-2/h5-6,13H,3-4,7-8H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | BJYCNKKKULLUBK-CJNGLKHVSA-N |
| XLogP | 1.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |