C30H31NO8 — CID 102406939
1,2-bis(3,4-dimethoxyphenyl)-10b-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-one (PubChem CID 102406939) has the molecular formula C30H31NO8 and a molecular weight of 533.58 g/mol. Its IUPAC name is 1,2-bis(3,4-dimethoxyphenyl)-10b-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-one.
| Compound Name | 1,2-bis(3,4-dimethoxyphenyl)-10b-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-one |
|---|---|
| PubChem CID | 102406939 |
| Molecular Formula | C30H31NO8 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 1,2-bis(3,4-dimethoxyphenyl)-10b-hydroxy-8,9-dimethoxy-5,6-dihydropyrrolo[2,1-a]isoquinolin-3-one |
| SMILES | COc1ccc(C2=C(c3ccc(OC)c(OC)c3)C3(O)c4cc(OC)c(OC)cc4CCN3C2=O)cc1OC |
| InChI | InChI=1S/C30H31NO8/c1-34-21-9-7-18(14-23(21)36-3)27-28(19-8-10-22(35-2)24(15-19)37-4)30(33)20-16-26(39-6)25(38-5)13-17(20)11-12-31(30)29(27)32/h7-10,13-16,33H,11-12H2,1-6H3 |
| InChIKey | JFSNKGKADNVYQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|