C20H23NO6 — CID 11632164
methyl 11,12-dimethoxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate (PubChem CID 11632164) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is methyl 11,12-dimethoxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate.
| Compound Name | methyl 11,12-dimethoxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 11632164 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | methyl 11,12-dimethoxy-3,6-dioxo-1,2,4,5,8,9-hexahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
| SMILES | COC(=O)C12CC(=O)CCC13c1cc(OC)c(OC)cc1CCN3C(=O)C2 |
| InChI | InChI=1S/C20H23NO6/c1-25-15-8-12-5-7-21-17(23)11-19(18(24)27-3)10-13(22)4-6-20(19,21)14(12)9-16(15)26-2/h8-9H,4-7,10-11H2,1-3H3 |
| InChIKey | PCOYTTGDBZXKFE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |