C22H25NO6S — CID 10717562
methyl (4aR,13bR)-2-ethylsulfanyl-11,12-dimethoxy-3,6-dioxo-4,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate (PubChem CID 10717562) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is methyl (4aR,13bR)-2-ethylsulfanyl-11,12-dimethoxy-3,6-dioxo-4,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate.
| Compound Name | methyl (4aR,13bR)-2-ethylsulfanyl-11,12-dimethoxy-3,6-dioxo-4,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 10717562 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | methyl (4aR,13bR)-2-ethylsulfanyl-11,12-dimethoxy-3,6-dioxo-4,5,8,9-tetrahydroindolo[7a,1-a]isoquinoline-4a-carboxylate |
| SMILES | CCSC1=C[C@]23c4cc(OC)c(OC)cc4CCN2C(=O)C[C@]3(C(=O)OC)CC1=O |
| InChI | InChI=1S/C22H25NO6S/c1-5-30-18-11-22-14-9-17(28-3)16(27-2)8-13(14)6-7-23(22)19(25)12-21(22,10-15(18)24)20(26)29-4/h8-9,11H,5-7,10,12H2,1-4H3/t21-,22+/m0/s1 |
| InChIKey | UEAGNNVQMJYFAW-FCHUYYIVSA-N |
| XLogP | 2.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |