C24H27NO6 — CID 633373
(4-ethoxy-6',7'-dimethoxy-2'-methyl-3-oxospiro[1H-indene-2,1'-3,4-dihydroisoquinoline]-5-yl) acetate (PubChem CID 633373) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is (4-ethoxy-6',7'-dimethoxy-2'-methyl-3-oxospiro[1H-indene-2,1'-3,4-dihydroisoquinoline]-5-yl) acetate.
| Compound Name | (4-ethoxy-6',7'-dimethoxy-2'-methyl-3-oxospiro[1H-indene-2,1'-3,4-dihydroisoquinoline]-5-yl) acetate |
|---|---|
| PubChem CID | 633373 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (4-ethoxy-6',7'-dimethoxy-2'-methyl-3-oxospiro[1H-indene-2,1'-3,4-dihydroisoquinoline]-5-yl) acetate |
| SMILES | CCOc1c(OC(C)=O)ccc2c1C(=O)C1(C2)c2cc(OC)c(OC)cc2CCN1C |
| InChI | InChI=1S/C24H27NO6/c1-6-30-22-18(31-14(2)26)8-7-16-13-24(23(27)21(16)22)17-12-20(29-5)19(28-4)11-15(17)9-10-25(24)3/h7-8,11-12H,6,9-10,13H2,1-5H3 |
| InChIKey | ASFYQNKVGPHKLP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|