C28H33NO6 — CID 135001643
methyl (1R,2S,3R,10bR)-1-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8,9-dimethoxy-3-methyl-2-phenyl-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline-3-carboxylate (PubChem CID 135001643) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is methyl (1R,2S,3R,10bR)-1-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8,9-dimethoxy-3-methyl-2-phenyl-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | methyl (1R,2S,3R,10bR)-1-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8,9-dimethoxy-3-methyl-2-phenyl-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 135001643 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | methyl (1R,2S,3R,10bR)-1-[(E)-3-ethoxy-3-oxoprop-1-enyl]-8,9-dimethoxy-3-methyl-2-phenyl-2,5,6,10b-tetrahydro-1H-pyrrolo[2,1-a]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](c2ccccc2)[C@](C)(C(=O)OC)N2CCc3cc(OC)c(OC)cc3[C@@H]12 |
| InChI | InChI=1S/C28H33NO6/c1-6-35-24(30)13-12-20-25(18-10-8-7-9-11-18)28(2,27(31)34-5)29-15-14-19-16-22(32-3)23(33-4)17-21(19)26(20)29/h7-13,16-17,20,25-26H,6,14-15H2,1-5H3/b13-12+/t20-,25-,26-,28-/m1/s1 |
| InChIKey | RXYYTSNRMMLNLP-NINDZOCOSA-N |
| XLogP | 4.07 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|