C15H16Cl3NO3 — CID 11793180
1,1-dichloro-9b-(1-chloroethyl)-7,8-dimethoxy-4,5-dihydroazeto[2,1-a]isoquinolin-2-one (PubChem CID 11793180) has the molecular formula C15H16Cl3NO3 and a molecular weight of 364.66 g/mol. Its IUPAC name is 1,1-dichloro-9b-(1-chloroethyl)-7,8-dimethoxy-4,5-dihydroazeto[2,1-a]isoquinolin-2-one.
| Compound Name | 1,1-dichloro-9b-(1-chloroethyl)-7,8-dimethoxy-4,5-dihydroazeto[2,1-a]isoquinolin-2-one |
|---|---|
| PubChem CID | 11793180 |
| Molecular Formula | C15H16Cl3NO3 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1,1-dichloro-9b-(1-chloroethyl)-7,8-dimethoxy-4,5-dihydroazeto[2,1-a]isoquinolin-2-one |
| SMILES | COc1cc2c(cc1OC)C1(C(C)Cl)N(CC2)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C15H16Cl3NO3/c1-8(16)14-10-7-12(22-3)11(21-2)6-9(10)4-5-19(14)13(20)15(14,17)18/h6-8H,4-5H2,1-3H3 |
| InChIKey | CQVCDXUIWATXTK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|