C20H28N2O3 — CID 146388646
(3R,11bR)-9,10-dimethoxy-11b-(methylideneamino)-3-(2-methylpropyl)-3,4,6,7-tetrahydro-1H-benzo[a]quinolizin-2-one (PubChem CID 146388646) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3R,11bR)-9,10-dimethoxy-11b-(methylideneamino)-3-(2-methylpropyl)-3,4,6,7-tetrahydro-1H-benzo[a]quinolizin-2-one.
| Compound Name | (3R,11bR)-9,10-dimethoxy-11b-(methylideneamino)-3-(2-methylpropyl)-3,4,6,7-tetrahydro-1H-benzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 146388646 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (3R,11bR)-9,10-dimethoxy-11b-(methylideneamino)-3-(2-methylpropyl)-3,4,6,7-tetrahydro-1H-benzo[a]quinolizin-2-one |
| SMILES | C=N[C@@]12CC(=O)[C@H](CC(C)C)CN1CCc1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C20H28N2O3/c1-13(2)8-15-12-22-7-6-14-9-18(24-4)19(25-5)10-16(14)20(22,21-3)11-17(15)23/h9-10,13,15H,3,6-8,11-12H2,1-2,4-5H3/t15-,20+/m1/s1 |
| InChIKey | HMTPBJWUBSWFGA-QRWLVFNGSA-N |
| XLogP | 3.05 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|