C27H45NO3Si — CID 42612714
[(1S,10bS)-10b-but-3-enyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-1-yl]oxy-tri(propan-2-yl)silane (PubChem CID 42612714) has the molecular formula C27H45NO3Si and a molecular weight of 459.75 g/mol. Its IUPAC name is [(1S,10bS)-10b-but-3-enyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-1-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,10bS)-10b-but-3-enyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-1-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 42612714 |
| Molecular Formula | C27H45NO3Si |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | [(1S,10bS)-10b-but-3-enyl-8,9-dimethoxy-2,3,5,6-tetrahydro-1H-pyrrolo[2,1-a]isoquinolin-1-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=CCC[C@@]12c3cc(OC)c(OC)cc3CCN1CC[C@@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H45NO3Si/c1-10-11-14-27-23-18-25(30-9)24(29-8)17-22(23)12-15-28(27)16-13-26(27)31-32(19(2)3,20(4)5)21(6)7/h10,17-21,26H,1,11-16H2,2-9H3/t26-,27-/m0/s1 |
| InChIKey | CDALNUBPLZEEAR-SVBPBHIXSA-N |
| XLogP | 6.69 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|