C13H17NO2 — CID 67861334
5,6-dimethoxy-1-prop-2-enyl-2,3-dihydroindole (PubChem CID 67861334) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 5,6-dimethoxy-1-prop-2-enyl-2,3-dihydroindole.
| Compound Name | 5,6-dimethoxy-1-prop-2-enyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 67861334 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 5,6-dimethoxy-1-prop-2-enyl-2,3-dihydroindole |
| SMILES | C=CCN1CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C13H17NO2/c1-4-6-14-7-5-10-8-12(15-2)13(16-3)9-11(10)14/h4,8-9H,1,5-7H2,2-3H3 |
| InChIKey | QXVKIOPNYYQBQJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|