C18H27NO3S — CID 169301963
(1R)-2-[(S)-tert-butylsulfinyl]-6,7-dimethoxy-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline (PubChem CID 169301963) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is (1R)-2-[(S)-tert-butylsulfinyl]-6,7-dimethoxy-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1R)-2-[(S)-tert-butylsulfinyl]-6,7-dimethoxy-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 169301963 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1R)-2-[(S)-tert-butylsulfinyl]-6,7-dimethoxy-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=CC[C@@H]1c2cc(OC)c(OC)cc2CCN1[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C18H27NO3S/c1-7-8-15-14-12-17(22-6)16(21-5)11-13(14)9-10-19(15)23(20)18(2,3)4/h7,11-12,15H,1,8-10H2,2-6H3/t15-,23+/m1/s1 |
| InChIKey | KEYNAMDYEKZPMG-CMJOXMDJSA-N |
| XLogP | 3.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|