C11H14N2O2 — CID 87513526
2-(6-amino-5-methoxy-2,3-dihydroindol-1-yl)acetaldehyde (PubChem CID 87513526) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(6-amino-5-methoxy-2,3-dihydroindol-1-yl)acetaldehyde.
| Compound Name | 2-(6-amino-5-methoxy-2,3-dihydroindol-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 87513526 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(6-amino-5-methoxy-2,3-dihydroindol-1-yl)acetaldehyde |
| SMILES | COc1cc2c(cc1N)N(CC=O)CC2 |
| InChI | InChI=1S/C11H14N2O2/c1-15-11-6-8-2-3-13(4-5-14)10(8)7-9(11)12/h5-7H,2-4,12H2,1H3 |
| InChIKey | MQHLUMABRXXLFS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|