C15H21N3O2 — CID 67316189
(6-amino-5-methoxy-2,3-dihydroindol-1-yl)-[(2S)-1-methylpyrrolidin-2-yl]methanone (PubChem CID 67316189) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (6-amino-5-methoxy-2,3-dihydroindol-1-yl)-[(2S)-1-methylpyrrolidin-2-yl]methanone.
| Compound Name | (6-amino-5-methoxy-2,3-dihydroindol-1-yl)-[(2S)-1-methylpyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 67316189 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (6-amino-5-methoxy-2,3-dihydroindol-1-yl)-[(2S)-1-methylpyrrolidin-2-yl]methanone |
| SMILES | COc1cc2c(cc1N)N(C(=O)[C@@H]1CCCN1C)CC2 |
| InChI | InChI=1S/C15H21N3O2/c1-17-6-3-4-12(17)15(19)18-7-5-10-8-14(20-2)11(16)9-13(10)18/h8-9,12H,3-7,16H2,1-2H3/t12-/m0/s1 |
| InChIKey | LKQQOLQSRBJDGR-LBPRGKRZSA-N |
| XLogP | 1.26 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|