C15H19N3O4 — CID 141233004
[(2S)-1-(deuteriomethyl)pyrrolidin-2-yl]-(5-methoxy-6-nitro-2,3-dihydroindol-1-yl)methanone (PubChem CID 141233004) has the molecular formula C15H19N3O4 and a molecular weight of 306.34 g/mol. Its IUPAC name is [(2S)-1-(deuteriomethyl)pyrrolidin-2-yl]-(5-methoxy-6-nitro-2,3-dihydroindol-1-yl)methanone.
| Compound Name | [(2S)-1-(deuteriomethyl)pyrrolidin-2-yl]-(5-methoxy-6-nitro-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 141233004 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [(2S)-1-(deuteriomethyl)pyrrolidin-2-yl]-(5-methoxy-6-nitro-2,3-dihydroindol-1-yl)methanone |
| SMILES | [2H]CN1CCC[C@H]1C(=O)N1CCc2cc(OC)c([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H19N3O4/c1-16-6-3-4-11(16)15(19)17-7-5-10-8-14(22-2)13(18(20)21)9-12(10)17/h8-9,11H,3-7H2,1-2H3/t11-/m0/s1/i1D |
| InChIKey | SVZMICOXNSLUAR-YUGCEPSCSA-N |
| XLogP | 1.59 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|