C15H20N2O4 — CID 134427446
4-(7-methoxy-6-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)morpholine (PubChem CID 134427446) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-(7-methoxy-6-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)morpholine.
| Compound Name | 4-(7-methoxy-6-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)morpholine |
|---|---|
| PubChem CID | 134427446 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-(7-methoxy-6-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)morpholine |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])CCC(N1CCOCC1)C2 |
| InChI | InChI=1S/C15H20N2O4/c1-20-15-10-12-8-13(16-4-6-21-7-5-16)3-2-11(12)9-14(15)17(18)19/h9-10,13H,2-8H2,1H3 |
| InChIKey | CRNRZXCRAWFMRT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|