C27H35N3O6 — CID 23324567
3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7-methoxy-8-nitro-2,5-dihydro-1H-3-benzazepin-4-one (PubChem CID 23324567) has the molecular formula C27H35N3O6 and a molecular weight of 497.59 g/mol. Its IUPAC name is 3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7-methoxy-8-nitro-2,5-dihydro-1H-3-benzazepin-4-one.
| Compound Name | 3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7-methoxy-8-nitro-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| PubChem CID | 23324567 |
| Molecular Formula | C27H35N3O6 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 3-[3-[(6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]propyl]-7-methoxy-8-nitro-2,5-dihydro-1H-3-benzazepin-4-one |
| SMILES | COc1cc2c(cc1OC)CC(N(C)CCCN1CCc3cc([N+](=O)[O-])c(OC)cc3CC1=O)CC2 |
| InChI | InChI=1S/C27H35N3O6/c1-28(22-7-6-18-14-25(35-3)26(36-4)16-20(18)12-22)9-5-10-29-11-8-19-13-23(30(32)33)24(34-2)15-21(19)17-27(29)31/h13-16,22H,5-12,17H2,1-4H3 |
| InChIKey | STIOATQWXIOGOR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|