About (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone
(5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone (PubChem CID 67315877) has the molecular formula C15H19N3O4
and a molecular weight of 305.33 g/mol. Its IUPAC name is (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone.
Molecular Properties
| Compound Name | (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone |
| PubChem CID | 67315877 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])N(C(=O)[C@H]1CCCN1C)CC2 |
| InChI | InChI=1S/C15H19N3O4/c1-16-6-3-4-11(16)15(19)17-7-5-10-8-14(22-2)13(18(20)21)9-12(10)17/h8-9,11H,3-7H2,1-2H3/t11-/m1/s1 |
| InChIKey | SVZMICOXNSLUAR-LLVKDONJSA-N |
| XLogP | 1.59 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone?
The IUPAC name of (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone (CID 67315877) is (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone.
What is the SMILES notation for (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone?
The canonical SMILES for (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone is COc1cc2c(cc1[N+](=O)[O-])N(C(=O)[C@H]1CCCN1C)CC2.
What is the InChIKey of (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone?
The InChIKey is SVZMICOXNSLUAR-LLVKDONJSA-N. The full InChI is InChI=1S/C15H19N3O4/c1-16-6-3-4-11(16)15(19)17-7-5-10-8-14(22-2)13(18(20)21)9-12(10)17/h8-9,11H,3-7H2,1-2H3/t11-/m1/s1.
What are the key properties of (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone?
(5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone has a molecular weight of 305.33 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methoxy-6-nitro-2,3-dihydroindol-1-yl)-[(2R)-1-methylpyrrolidin-2-yl]methanone is sourced from PubChem (CID 67315877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).