C17H19N3O7 — CID 58147680
6-methoxy-7-nitro-2-(2-oxo-2-pyrrolidin-1-ylacetyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 58147680) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is 6-methoxy-7-nitro-2-(2-oxo-2-pyrrolidin-1-ylacetyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 6-methoxy-7-nitro-2-(2-oxo-2-pyrrolidin-1-ylacetyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 58147680 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 6-methoxy-7-nitro-2-(2-oxo-2-pyrrolidin-1-ylacetyl)-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C(C(=O)O)N(C(=O)C(=O)N1CCCC1)CC2 |
| InChI | InChI=1S/C17H19N3O7/c1-27-13-8-10-4-7-19(16(22)15(21)18-5-2-3-6-18)14(17(23)24)11(10)9-12(13)20(25)26/h8-9,14H,2-7H2,1H3,(H,23,24) |
| InChIKey | MXHKHHDYFSEHMU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|