C25H27N3O7S — CID 58124882
2-[2-[tert-butyl(4-thiophen-2-ylbut-3-ynyl)amino]-2-oxoacetyl]-6-methoxy-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 58124882) has the molecular formula C25H27N3O7S and a molecular weight of 513.57 g/mol. Its IUPAC name is 2-[2-[tert-butyl(4-thiophen-2-ylbut-3-ynyl)amino]-2-oxoacetyl]-6-methoxy-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 2-[2-[tert-butyl(4-thiophen-2-ylbut-3-ynyl)amino]-2-oxoacetyl]-6-methoxy-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 58124882 |
| Molecular Formula | C25H27N3O7S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 2-[2-[tert-butyl(4-thiophen-2-ylbut-3-ynyl)amino]-2-oxoacetyl]-6-methoxy-7-nitro-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C(C(=O)O)N(C(=O)C(=O)N(CCC#Cc1cccs1)C(C)(C)C)CC2 |
| InChI | InChI=1S/C25H27N3O7S/c1-25(2,3)27(11-6-5-8-17-9-7-13-36-17)23(30)22(29)26-12-10-16-14-20(35-4)19(28(33)34)15-18(16)21(26)24(31)32/h7,9,13-15,21H,6,10-12H2,1-4H3,(H,31,32) |
| InChIKey | OKYLDCVIMPKSNX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|