C27H32BrN3O5S — CID 66919686
7-bromo-2-[2-[tert-butyl-[7-(1,3-thiazol-4-yl)hept-6-ynyl]amino]-2-oxoacetyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 66919686) has the molecular formula C27H32BrN3O5S and a molecular weight of 590.54 g/mol. Its IUPAC name is 7-bromo-2-[2-[tert-butyl-[7-(1,3-thiazol-4-yl)hept-6-ynyl]amino]-2-oxoacetyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-1-carboxylic acid.
| Compound Name | 7-bromo-2-[2-[tert-butyl-[7-(1,3-thiazol-4-yl)hept-6-ynyl]amino]-2-oxoacetyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 66919686 |
| Molecular Formula | C27H32BrN3O5S |
| Molecular Weight | 590.54 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 7-bromo-2-[2-[tert-butyl-[7-(1,3-thiazol-4-yl)hept-6-ynyl]amino]-2-oxoacetyl]-6-methoxy-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| SMILES | COc1cc2c(cc1Br)C(C(=O)O)N(C(=O)C(=O)N(CCCCCC#Cc1cscn1)C(C)(C)C)CC2 |
| InChI | InChI=1S/C27H32BrN3O5S/c1-27(2,3)31(12-9-7-5-6-8-10-19-16-37-17-29-19)25(33)24(32)30-13-11-18-14-22(36-4)21(28)15-20(18)23(30)26(34)35/h14-17,23H,5-7,9,11-13H2,1-4H3,(H,34,35) |
| InChIKey | ZWMZBCCGWOIQDN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|