C14H18N2O2 — CID 2759427
1-(2-isocyanoethyl)-6,7-dimethoxy-3,4-dihydro-2H-quinoline (PubChem CID 2759427) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(2-isocyanoethyl)-6,7-dimethoxy-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2-isocyanoethyl)-6,7-dimethoxy-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 2759427 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(2-isocyanoethyl)-6,7-dimethoxy-3,4-dihydro-2H-quinoline |
| SMILES | [C-]#[N+]CCN1CCCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C14H18N2O2/c1-15-6-8-16-7-4-5-11-9-13(17-2)14(18-3)10-12(11)16/h9-10H,4-8H2,2-3H3 |
| InChIKey | WPMQHVMQCASYDM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|