C18H21NO4 — CID 11324508
4-[(10bR)-8,9-dimethoxy-3-oxo-5,6-dihydropyrrolo[2,1-a]isoquinolin-10b-yl]butanal (PubChem CID 11324508) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-[(10bR)-8,9-dimethoxy-3-oxo-5,6-dihydropyrrolo[2,1-a]isoquinolin-10b-yl]butanal.
| Compound Name | 4-[(10bR)-8,9-dimethoxy-3-oxo-5,6-dihydropyrrolo[2,1-a]isoquinolin-10b-yl]butanal |
|---|---|
| PubChem CID | 11324508 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-[(10bR)-8,9-dimethoxy-3-oxo-5,6-dihydropyrrolo[2,1-a]isoquinolin-10b-yl]butanal |
| SMILES | COc1cc2c(cc1OC)[C@@]1(CCCC=O)C=CC(=O)N1CC2 |
| InChI | InChI=1S/C18H21NO4/c1-22-15-11-13-6-9-19-17(21)5-8-18(19,7-3-4-10-20)14(13)12-16(15)23-2/h5,8,10-12H,3-4,6-7,9H2,1-2H3/t18-/m1/s1 |
| InChIKey | SAZCNOHDLWQKHB-GOSISDBHSA-N |
| XLogP | 2.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|